[ol7_developer_EPEL] perl-SNMP-Info-2.11-2.el7.noarch

Name:	perl-SNMP-Info
Version:	2.11
Release:	2.el7
Architecture:	noarch
Group:	Development/Libraries
Size:	1645456
License:	BSD
RPM:	perl-SNMP-Info-2.11-2.el7.noarch.rpm
Source RPM:	perl-SNMP-Info-2.11-2.el7.src.rpm
Build Date:	Fri Nov 03 2017
Build Host:	x86-ol7-builder-01.us.oracle.com
Vendor:	Oracle America
URL:	http://search.cpan.org/dist/SNMP-Info/
Summary:	Object Oriented Perl5 Interface to Network devices and MIBs through SNMP
Description:	SNMP::Info gives an object oriented interface to information obtained through SNMP.

Related Packages (Show Changelog) (Show Filelist)

Provides
- perl(SNMP::Info) = 2.11
- perl(SNMP::Info::AdslLine) = 2.11
- perl(SNMP::Info::Airespace) = 2.11
- perl(SNMP::Info::Bridge) = 2.11
- perl(SNMP::Info::CDP) = 2.11
- perl(SNMP::Info::CiscoConfig) = 2.11
- perl(SNMP::Info::CiscoImage) = 2.11
- perl(SNMP::Info::CiscoPortSecurity) = 2.11
- perl(SNMP::Info::CiscoPower) = 2.11
- perl(SNMP::Info::CiscoQOS) = 2.11
- perl(SNMP::Info::CiscoRTT) = 2.11
- perl(SNMP::Info::CiscoStack) = 2.11
- perl(SNMP::Info::CiscoStats) = 2.11
- perl(SNMP::Info::CiscoStpExtensions) = 2.11
- perl(SNMP::Info::CiscoVTP) = 2.11
- perl(SNMP::Info::EDP) = 2.11
- perl(SNMP::Info::Entity) = 2.11
- perl(SNMP::Info::EtherLike) = 2.11
- perl(SNMP::Info::FDP) = 2.11
- perl(SNMP::Info::IEEE802dot11) = 2.11
- perl(SNMP::Info::IPv6) = 2.11
- perl(SNMP::Info::LLDP) = 2.11
- perl(SNMP::Info::Layer1) = 2.11
- perl(SNMP::Info::Layer1::Allied) = 2.11
- perl(SNMP::Info::Layer1::Asante) = 2.11
- perl(SNMP::Info::Layer1::Bayhub) = 2.11
- perl(SNMP::Info::Layer1::Cyclades) = 2.11
- perl(SNMP::Info::Layer1::S3000) = 2.11
- perl(SNMP::Info::Layer2) = 2.11
- perl(SNMP::Info::Layer2::Airespace) = 2.11
- perl(SNMP::Info::Layer2::Aironet) = 2.11
- perl(SNMP::Info::Layer2::Allied) = 2.11
- perl(SNMP::Info::Layer2::Bay) = 2.11
- perl(SNMP::Info::Layer2::Baystack) = 2.11
- perl(SNMP::Info::Layer2::C1900) = 2.11
- perl(SNMP::Info::Layer2::C2900) = 2.11
- perl(SNMP::Info::Layer2::Catalyst) = 2.11
- perl(SNMP::Info::Layer2::Centillion) = 2.11
- perl(SNMP::Info::Layer2::Cisco) = 2.11
- perl(SNMP::Info::Layer2::Foundry) = 2.11
- perl(SNMP::Info::Layer2::HP) = 2.11
- perl(SNMP::Info::Layer2::HP4000) = 2.11
- perl(SNMP::Info::Layer2::HPVC) = 2.11
- perl(SNMP::Info::Layer2::Kentrox) = 2.11
- perl(SNMP::Info::Layer2::N2270) = 2.11
- perl(SNMP::Info::Layer2::NAP222x) = 2.11
- perl(SNMP::Info::Layer2::Netgear) = 2.11
- perl(SNMP::Info::Layer2::Orinoco) = 2.11
- perl(SNMP::Info::Layer2::ZyXEL_DSLAM) = 2.11
- perl(SNMP::Info::Layer3) = 2.11
- perl(SNMP::Info::Layer3::Aironet) = 2.11
- perl(SNMP::Info::Layer3::AlcatelLucent) = 2.11
- perl(SNMP::Info::Layer3::AlteonAD) = 2.11
- perl(SNMP::Info::Layer3::Altiga) = 2.11
- perl(SNMP::Info::Layer3::Arista) = 2.11
- perl(SNMP::Info::Layer3::Aruba) = 2.11
- perl(SNMP::Info::Layer3::BayRS) = 2.11
- perl(SNMP::Info::Layer3::BlueCoatSG) = 2.11
- perl(SNMP::Info::Layer3::C3550) = 2.11
- perl(SNMP::Info::Layer3::C4000) = 2.11
- perl(SNMP::Info::Layer3::C6500) = 2.11
- perl(SNMP::Info::Layer3::Cisco) = 2.11
- perl(SNMP::Info::Layer3::CiscoFWSM) = 2.11
- perl(SNMP::Info::Layer3::Contivity) = 2.11
- perl(SNMP::Info::Layer3::Dell) = 2.11
- perl(SNMP::Info::Layer3::Enterasys) = 2.11
- perl(SNMP::Info::Layer3::Extreme) = 2.11
- perl(SNMP::Info::Layer3::Force10) = 2.11
- perl(SNMP::Info::Layer3::Foundry) = 2.11
- perl(SNMP::Info::Layer3::HP9300) = 2.11
- perl(SNMP::Info::Layer3::Juniper) = 2.11
- perl(SNMP::Info::Layer3::Microsoft) = 2.11
- perl(SNMP::Info::Layer3::Mikrotik) = 2.11
- perl(SNMP::Info::Layer3::N1600) = 2.11
- perl(SNMP::Info::Layer3::NetSNMP) = 2.11
- perl(SNMP::Info::Layer3::Netscreen) = 2.11
- perl(SNMP::Info::Layer3::Nexus) = 2.11
- perl(SNMP::Info::Layer3::PacketFront) = 2.11
- perl(SNMP::Info::Layer3::Passport) = 2.11
- perl(SNMP::Info::Layer3::Pf) = 2.11
- perl(SNMP::Info::Layer3::SonicWALL) = 2.11
- perl(SNMP::Info::Layer3::Sun) = 2.11
- perl(SNMP::Info::Layer3::Tasman) = 2.11
- perl(SNMP::Info::Layer3::Timetra) = 2.11
- perl(SNMP::Info::Layer7) = 2.11
- perl(SNMP::Info::Layer7::APC) = 2.11
- perl(SNMP::Info::Layer7::Neoteris) = 2.11
- perl(SNMP::Info::MAU) = 2.11
- perl(SNMP::Info::NortelStack) = 2.11
- perl(SNMP::Info::PowerEthernet) = 2.11
- perl(SNMP::Info::RapidCity) = 2.11
- perl(SNMP::Info::SONMP) = 2.11
- perl-SNMP-Info = 2.11-2.el7
Requires